Skip to content

MAT Preparation | admissions - Wyatt's Notes

The Mathematics Admissions Test (MAT) is used by the University of Oxford and Imperial College London As part of their undergraduate admissions process for mathematics and joint degree courses. It is also Used by the University of Warwick for certain applicants.

The MAT is a 2.5-hour paper. It consists of:

SectionFormatQuestionsMarks
AMultiple choiceQ1 (10 parts)40
B—DLong-formQ2, Q3, Q4 (choose 2 of 3)30 each

Total: 100 marks. All candidates must attempt Question 1 and choose two of Questions 2—4.

The MAT syllabus is based on the content of A-Level Mathematics. It does not require A-Level Further Mathematics, though familiarity with Further Mathematics topics can be helpful. Key topics:

  • Algebra: quadratics, polynomials, inequalities, partial fractions
  • Calculus: differentiation, integration, curve sketching
  • Geometry: coordinate geometry, trigonometry
  • Sequences and series: arithmetic, geometric, recurrence relations
  • Logic and proof: proof by contradiction, induction, counterexamples
  • Combinatorics: counting principles, basic probability
  • Questions require original thinking, not just recall of standard methods.
  • Multiple choice options are designed to trap common misconceptions.
  • Long-form questions have multiple parts that build in difficulty.
  • The exam tests mathematical maturity: the ability to apply known results in unfamiliar settings.

The average score is around 50—60 out of 100. A competitive Oxford applicant generally Aims for 65 or above, though the threshold varies by year and by college. The questions are designed To discriminate at the top end: the final parts of Questions 2—4 are intended to challenge even The strongest candidates.


Question 1 consists of 10 multiple choice parts, each worth 4 marks. Each part presents a mathematical Statement or computation with five options (A—E).

Eliminate before you compute. Read all five options before starting to work. Often two or three Options can be eliminated immediately by dimensional analysis, symmetry considerations, or testing Special cases.

Test specific values. If a statement claims a property holds for all xxTest x=0x = 0, x=1x = 1 And x=1x = -1. If it fails for any of these, the statement is false.

Check edge cases. For statements about functions, consider what happens at the boundaries of the Domain, at zeros, and at extreme values.

Use the options against each other. If two options are contradictory, exactly one must be false. If options A and B differ only in the sign of a term, determining the sign of that term eliminates One.

The “almost right” answer. A common error (e.g., forgetting a factor of 2, dropping a sign, or Missing a case) produces one of the wrong options. If your computation leads to an option, verify the Steps that are most likely to contain errors.

The “too specific” answer. An answer that is correct only for a special case of the problem. For Example, an answer derived by assuming n=1n = 1 when the statement should hold for all nn.

The “reverse implication” trap. Confusing P    QP \implies Q with Q    PQ \implies P. Many multiple Choice parts test logical reasoning precisely through this confusion.


The discriminant of ax2+bx+c=0ax^2 + bx + c = 0 determines the nature of its roots:

Δ=b24ac\Delta = b^2 - 4acRoots
Δ>0\Delta > 0Two distinct real roots
Δ=0\Delta = 0One repeated real root
Δ<0\Delta < 0No real roots

Completing the square. ax2+bx+c=a(x+b2a)2Δ4aax^2 + bx + c = a\left(x + \frac{b}{2a}\right)^2 - \frac{\Delta}{4a}.

This form reveals the vertex, the minimum or maximum value, and the axis of symmetry.

Polynomial division. When dividing P(x)P(x) by Q(x)Q(x)Write P(x)=Q(x)D(x)+R(x)P(x) = Q(x)D(x) + R(x) where degR<degQ\deg R < \deg Q.

Factor theorem applications. If P(a)=0P(a) = 0 Then (xa)(x - a) divides P(x)P(x). This is frequently Used to find roots of polynomials that arise from algebraic manipulation.

Function composition. (fg)(x)=f(g(x))(f \circ g)(x) = f(g(x)). Note that composition is not commutative: fggff \circ g \neq g \circ f .

Inverse functions. f1f^{-1} exists if and only if ff is bijective. To find f1f^{-1}Set y=f(x)y = f(x) and solve for xx in terms of yy.

Transformations. The graph of y=af(bx+c)+dy = af(bx + c) + d is obtained from y=f(x)y = f(x) by:

  • Horizontal translation by c/b-c/b
  • Horizontal stretch by factor 1/b1/|b| (reflection in yy-axis if b<0b < 0)
  • Vertical stretch by factor a|a| (reflection in xx-axis if a<0a < 0)
  • Vertical translation by dd

Technique: squaring both sides. If a,b0a, b \geq 0 Then ab    a2b2a \geq b \iff a^2 \geq b^2. If the Signs are unknown, squaring is not valid.

Technique: considering cases. For absolute value inequalities, split into cases based on the sign Of the expression inside the absolute value.

Technique: using known inequalities. AM-GM, Cauchy-Schwarz, and the triangle inequality are Powerful tools that frequently appear on MAT.


Standard derivatives.

f(x)f(x)f"(x)f"(x)
xnx^nnxn1nx^{n-1}
exe^xexe^x
lnx\ln x1/x1/x
sinx\sin xcosx\cos x
cosx\cos xsinx-\sin x
tanx\tan xsec2x\sec^2 x
arcsinx\arcsin x1/1x21/\sqrt{1 - x^2}
arctanx\arctan x1/(1+x2)1/(1 + x^2)

Chain rule. ddx[f(g(x))]=f(g(x))g(x)\frac{d}{dx}[f(g(x))] = f'(g(x)) \cdot g'(x).

Product rule. ddx[f(x)g(x)]=f(x)g(x)+f(x)g(x)\frac{d}{dx}[f(x)g(x)] = f'(x)g(x) + f(x)g'(x).

Quotient rule. ddx[f(x)g(x)]=f(x)g(x)f(x)g(x)g(x)2\frac{d}{dx}\left[\frac{f(x)}{g(x)}\right] = \frac{f'(x)g(x) - f(x)g'(x)}{g(x)^2}.

Implicit differentiation. When yy is defined implicitly by F(x,y)=0F(x, y) = 0Differentiate both Sides with respect to xxTreating yy as a function of xx:

ddx[F(x,y)]=Fx+Fydydx=0\frac{d}{dx}[F(x, y)] = \frac{\partial F}{\partial x} + \frac{\partial F}{\partial y}\frac{dy}{dx} = 0

Standard integrals.

| f(x)dx\int f(x)\,dx | Result | | -------------------------- | --------------------------------------- | --- | ---- | | xndx\int x^n\,dx | xn+1n+1+C\frac{x^{n+1}}{n+1} + C (n1n \neq -1) | | 1xdx\int \frac{1}{x}\,dx | lnx+C\ln | x | + C | | exdx\int e^x\,dx | ex+Ce^x + C | | sinxdx\int \sin x\,dx | cosx+C-\cos x + C | | cosxdx\int \cos x\,dx | sinx+C\sin x + C | | sec2xdx\int \sec^2 x\,dx | tanx+C\tan x + C | | 11+x2dx\int \frac{1}{1+x^2}\,dx | arctanx+C\arctan x + C |

Techniques. Substitution, integration by parts, partial fractions, and trigonometric identities Are the core techniques. MAT questions require one or two applications of these, combined With algebraic manipulation.

Definite integrals. abf(x)dx=F(b)F(a)\int_a^b f(x)\,dx = F(b) - F(a). Properties:

  • abf(x)dx=baf(x)dx\int_a^b f(x)\,dx = -\int_b^a f(x)\,dx
  • ab[f(x)+g(x)]dx=abf(x)dx+abg(x)dx\int_a^b [f(x) + g(x)]\,dx = \int_a^b f(x)\,dx + \int_a^b g(x)\,dx
  • If f(x)0f(x) \geq 0 on [a,b][a, b] Then abf(x)dx0\int_a^b f(x)\,dx \geq 0

Stationary points. Set f(x)=0f'(x) = 0. Classify using the second derivative:

  • f(x)>0f''(x) > 0: local minimum
  • f(x)<0f''(x) < 0: local maximum
  • f(x)=0f''(x) = 0: test fails; use first derivative test or higher derivatives

Points of inflection. Where f(x)=0f''(x) = 0 and f(x)f''(x) changes sign.

Asymptotes. Vertical asymptotes at values where ff is undefined. Horizontal asymptotes from limx±f(x)\lim_{x \to \pm\infty} f(x). Oblique asymptotes when the degree of the numerator is one more than The denominator: divide to find f(x)=mx+c+r(x)s(x)f(x) = mx + c + \frac{r(x)}{s(x)}.

Curve sketching procedure.

  1. Domain and range
  2. Symmetry (even/odd, periodic)
  3. Intercepts (x-axis and y-axis)
  4. Asymptotes
  5. Stationary points and their nature
  6. Behaviour at extremes of the domain
  7. Sketch, labelling key features

The nn-th term: an=a1+(n1)da_n = a_1 + (n-1)dWhere dd is the common difference.

Sum of the first nn terms: Sn=n2(2a1+(n1)d)=n2(a1+an)S_n = \frac{n}{2}(2a_1 + (n-1)d) = \frac{n}{2}(a_1 + a_n).

The nn-th term: an=a1rn1a_n = a_1 r^{n-1}Where rr is the common ratio.

Sum of the first nn terms: Sn=a1(1rn)1rS_n = \frac{a_1(1 - r^n)}{1 - r} for r1r \neq 1.

Sum to infinity: S=a11rS_\infty = \frac{a_1}{1 - r}Convergent for r<1|r| < 1.

A recurrence relation defines ana_n in terms of previous terms. A first-order linear recurrence:

an+1=ran+ca_{n+1} = ra_n + c

Has the general solution:

an=Arn1+c1ra_n = A r^{n-1} + \frac{c}{1 - r}

For r1r \neq 1Where AA is determined by the initial condition.

Telescoping series. Terms cancel in pairs. For example:

k=1n1k(k+1)=k=1n(1k1k+1)=11n+1=nn+1\sum_{k=1}^{n} \frac{1}{k(k+1)} = \sum_{k=1}^{n} \left(\frac{1}{k} - \frac{1}{k+1}\right) = 1 - \frac{1}{n+1} = \frac{n}{n+1}

Method of differences. If ak=f(k)f(k1)a_k = f(k) - f(k-1) Then k=1nak=f(n)f(0)\sum_{k=1}^{n} a_k = f(n) - f(0). The key is finding ff given aka_kOften by partial fraction decomposition.

Binomial expansion. For x<1|x| < 1 and αR\alpha \in \mathbb{R}:

(1+x)α=k=0(αk)xk(1 + x)^\alpha = \sum_{k=0}^{\infty} \binom{\alpha}{k} x^k

Where (αk)=α(α1)(αk+1)k!\binom{\alpha}{k} = \frac{\alpha(\alpha-1)\cdots(\alpha-k+1)}{k!}.


StatementMeaning
P    QP \implies QIf PP is true, then QQ is true
P    QP \iff QPP is true if and only if QQ is true
¬P\neg PPP is false
PQP \land QBoth PP and QQ are true
PQP \lor QAt least one of PP or QQ is true
P    QP \implies Q¬PQ\neg P \lor Q (equivalent form)
¬(P    Q)\neg(P \implies Q)P¬QP \land \neg Q
  • xP(x)\forall x \, P(x): P(x)P(x) holds for all xx in the domain.
  • xP(x)\exists x \, P(x): there exists an xx in the domain such that P(x)P(x) holds.

Negation:

¬(xP(x))x¬P(x)\neg(\forall x \, P(x)) \equiv \exists x \, \neg P(x)

¬(xP(x))x¬P(x)\neg(\exists x \, P(x)) \equiv \forall x \, \neg P(x)

Direct proof. Assume PPDerive QQ through a sequence of logical steps.

Proof by contradiction. Assume ¬Q\neg Q and derive a contradiction. This proves QQ.

Proof by contrapositive. To prove P    QP \implies QProve ¬Q    ¬P\neg Q \implies \neg P instead.

Counterexample. To disprove a universal statement xP(x)\forall x \, P(x)Find a specific xx for Which P(x)P(x) is false.

Mathematical induction. To prove a statement for all nn0n \geq n_0:

  1. Base case: verify the statement for n=n0n = n_0.
  2. Inductive step: assume the statement for n=kn = k (inductive hypothesis), and prove it for n=k+1n = k + 1.
  3. Conclusion: by the principle of mathematical induction, the statement holds for all nn0n \geq n_0.
  • Showing a function is injective: assume f(a)=f(b)f(a) = f(b) and prove a=ba = b.
  • Showing a function is surjective: for every yy in the codomain, find xx with f(x)=yf(x) = y.
  • Proving an inequality by induction or by algebraic manipulation.
  • Determining whether a statement is “always”, “sometimes”, or “never” true, with justification.

Let f(x)=x33x+1f(x) = x^3 - 3x + 1. How many stationary points does the graph of y=f(f(x))y = f(f(x)) have?

Solution. By the chain rule:

ddx[f(f(x))]=f(f(x))f(x)\frac{d}{dx}[f(f(x))] = f'(f(x)) \cdot f'(x)

Stationary points occur where f(f(x))f(x)=0f'(f(x)) \cdot f'(x) = 0I.e., where f(x)=0f'(x) = 0 or f(f(x))=0f'(f(x)) = 0.

First, f(x)=3x23=3(x+1)(x1)=0f'(x) = 3x^2 - 3 = 3(x+1)(x-1) = 0 gives x=1x = -1 or x=1x = 1. These are 2 stationary points.

Second, f(f(x))=0f'(f(x)) = 0 means f(x)=1f(x) = -1 or f(x)=1f(x) = 1.

For f(x)=1f(x) = -1: x33x+1=1x^3 - 3x + 1 = -1I.e., x33x+2=0x^3 - 3x + 2 = 0. Since x=1x = 1 is a root: (x1)(x2+x2)=(x1)2(x+2)=0(x-1)(x^2 + x - 2) = (x-1)^2(x+2) = 0. Roots: x=1x = 1 (double), x=2x = -2. The root x=1x = 1 was Already counted, so this gives one new stationary point at x=2x = -2.

For f(x)=1f(x) = 1: x33x+1=1x^3 - 3x + 1 = 1I.e., x33x=0x^3 - 3x = 0I.e., x(x23)=0x(x^2 - 3) = 0. Roots: x=0,x=3,x=3x = 0, x = \sqrt{3}, x = -\sqrt{3}. These are all new stationary points.

Total: 2+1+3=62 + 1 + 3 = 6 stationary points.


(i) Show that if nn is a positive integer, then n5nn^5 - n is divisible by 5.

(ii) Hence, or otherwise, show that n5nn^5 - n is divisible by 30 for all positive integers nn.

Solution.

(i) By Fermat’s little theorem, for any integer nn not divisible by 5, n41(mod5)n^4 \equiv 1 \pmod{5} So n5n(mod5)n^5 \equiv n \pmod{5}Giving n5n0(mod5)n^5 - n \equiv 0 \pmod{5}.

Alternatively, by factorisation:

n5n=n(n41)=n(n21)(n2+1)=n(n1)(n+1)(n2+1)n^5 - n = n(n^4 - 1) = n(n^2 - 1)(n^2 + 1) = n(n-1)(n+1)(n^2 + 1)

Among any 5 consecutive integers, one is divisible by 5. The product n(n1)(n+1)n(n-1)(n+1) gives three Consecutive integers. If none of these is divisible by 5, then n2(mod5)n \equiv 2 \pmod{5} or n3(mod5)n \equiv 3 \pmod{5}. In the first case n24(mod5)n^2 \equiv 4 \pmod{5} So n2+10(mod5)n^2 + 1 \equiv 0 \pmod{5}. In the second case n294(mod5)n^2 \equiv 9 \equiv 4 \pmod{5} So n2+10(mod5)n^2 + 1 \equiv 0 \pmod{5}. Either way, The product is divisible by 5.

(ii) We have n5n=(n1)n(n+1)(n2+1)n^5 - n = (n-1)n(n+1)(n^2 + 1).

Divisibility by 2: (n1)n(n+1)(n-1)n(n+1) is the product of three consecutive integers, so at least one is Even. Therefore n5nn^5 - n is divisible by 2.

Divisibility by 3: (n1)n(n+1)(n-1)n(n+1) is the product of three consecutive integers, so one is divisible By 3. Therefore n5nn^5 - n is divisible by 3.

Divisibility by 5: established in part (i).

Since 2, 3, and 5 are pairwise coprime and n5nn^5 - n is divisible by all three, it is divisible by 2×3×5=302 \times 3 \times 5 = 30.


The curve CC has equation y=x2x1y = \frac{x^2}{x - 1}.

(i) Find the coordinates of the stationary points and determine their nature. (ii) Find the equations of any asymptotes. (iii) Sketch the curve, indicating all key features.

Solution.

(i) Using the quotient rule:

dydx=(2x)(x1)x2(1)(x1)2=2x22xx2(x1)2=x22x(x1)2=x(x2)(x1)2\frac{dy}{dx} = \frac{(2x)(x-1) - x^2(1)}{(x-1)^2} = \frac{2x^2 - 2x - x^2}{(x-1)^2} = \frac{x^2 - 2x}{(x-1)^2} = \frac{x(x-2)}{(x-1)^2}

Setting dydx=0\frac{dy}{dx} = 0: x(x2)=0x(x - 2) = 0 So x=0x = 0 or x=2x = 2.

At x=0x = 0: y=0y = 0. The second derivative:

d2ydx2=ddx[x22x(x1)2]\frac{d^2y}{dx^2} = \frac{d}{dx}\left[\frac{x^2 - 2x}{(x-1)^2}\right]

At x=0x = 0The numerator x22xx^2 - 2x changes from positive (for x<0x < 0) to negative (for 0<x<10 < x < 1), So dydx\frac{dy}{dx} changes from positive to negative. Hence (0,0)(0, 0) is a local maximum.

At x=2x = 2: y=41=4y = \frac{4}{1} = 4. The derivative changes from negative to positive, so (2,4)(2, 4) is a Local minimum.

(ii) Vertical asymptote at x=1x = 1. For the horizontal/oblique asymptote, divide:

x2x1=x+1+1x1\frac{x^2}{x - 1} = x + 1 + \frac{1}{x - 1}

As x±x \to \pm\infty, 1x10\frac{1}{x-1} \to 0 So yx+1y \approx x + 1. The oblique asymptote is y=x+1y = x + 1.

(iii) Key features for the sketch:

  • Domain: x1x \neq 1
  • Intercepts: (0,0)(0, 0)
  • Stationary points: local maximum at (0,0)(0, 0)Local minimum at (2,4)(2, 4)
  • Vertical asymptote: x=1x = 1
  • Oblique asymptote: y=x+1y = x + 1
  • As x1+x \to 1^+, y+y \to +\infty; as x1x \to 1^-, yy \to -\infty

Let Sn=k=1nk2kS_n = \sum_{k=1}^{n} \frac{k}{2^k}.

(i) Find S1,S2,S3S_1, S_2, S_3. (ii) Find an expression for SnS_n in terms of nn. (iii) Find k=1k2k\sum_{k=1}^{\infty} \frac{k}{2^k}.

Solution.

(i) S1=12S_1 = \frac{1}{2}, S2=12+24=1S_2 = \frac{1}{2} + \frac{2}{4} = 1, S3=1+38=118S_3 = 1 + \frac{3}{8} = \frac{11}{8}.

(ii) Write:

Sn=k=1nk2kS_n = \sum_{k=1}^{n} \frac{k}{2^k}

Multiply by 12\frac{1}{2}:

12Sn=k=1nk2k+1=k=2n+1k12k\frac{1}{2}S_n = \sum_{k=1}^{n} \frac{k}{2^{k+1}} = \sum_{k=2}^{n+1} \frac{k-1}{2^k}

Subtract:

Sn12Sn=12+k=2nk(k1)2kn2n+1S_n - \frac{1}{2}S_n = \frac{1}{2} + \sum_{k=2}^{n} \frac{k - (k-1)}{2^k} - \frac{n}{2^{n+1}}

12Sn=12+k=2n12kn2n+1\frac{1}{2}S_n = \frac{1}{2} + \sum_{k=2}^{n} \frac{1}{2^k} - \frac{n}{2^{n+1}}

12Sn=k=1n12kn2n+1\frac{1}{2}S_n = \sum_{k=1}^{n} \frac{1}{2^k} - \frac{n}{2^{n+1}}

The geometric sum k=1n12k=12(112n)112=112n\sum_{k=1}^{n} \frac{1}{2^k} = \frac{\frac{1}{2}(1 - \frac{1}{2^n})}{1 - \frac{1}{2}} = 1 - \frac{1}{2^n}.

Therefore:

12Sn=112nn2n+1=12+n2n+1\frac{1}{2}S_n = 1 - \frac{1}{2^n} - \frac{n}{2^{n+1}} = 1 - \frac{2 + n}{2^{n+1}}

Sn=2n+22nS_n = 2 - \frac{n + 2}{2^n}

(iii) k=1k2k=limnSn=limn(2n+22n)=20=2\sum_{k=1}^{\infty} \frac{k}{2^k} = \lim_{n \to \infty} S_n = \lim_{n \to \infty} \left(2 - \frac{n+2}{2^n}\right) = 2 - 0 = 2.


A function f:RRf: \mathbb{R} \to \mathbb{R} satisfies f(x+y)=f(x)+f(y)f(x+y) = f(x) + f(y) for all x,yRx, y \in \mathbb{R} and f(xy)=f(x)f(y)f(xy) = f(x)f(y) for all x,yRx, y \in \mathbb{R}.

(i) Find f(0)f(0) and f(1)f(1). (ii) Show that f(n)=nf(1)f(n) = n f(1) for all nZn \in \mathbb{Z}. (iii) Show that either f(x)=xf(x) = x for all xRx \in \mathbb{R}Or f(x)=0f(x) = 0 for all xRx \in \mathbb{R}.

Solution.

(i) Setting x=y=0x = y = 0: f(0)=f(0)+f(0)=2f(0)f(0) = f(0) + f(0) = 2f(0) So f(0)=0f(0) = 0.

Setting y=1y = 1: f(x)=f(x)+f(1)f(x) = f(x) + f(1) So f(1)=0f(1) = 0.

Wait: f(x1)=f(x)f(1)f(x \cdot 1) = f(x)f(1). Since f(x1)=f(x)f(x \cdot 1) = f(x)We have f(x)=f(x)f(1)f(x) = f(x)f(1) for all xx. This means f(x)(1f(1))=0f(x)(1 - f(1)) = 0 for all xx.

Case 1: f(1)1f(1) \neq 1. Then f(x)=0f(x) = 0 for all xxWhich satisfies both conditions.

Case 2: f(1)=1f(1) = 1. Then from f(1)=1f(1) = 1Setting x=y=0x = y = 0 in the additive property gives f(0)=0f(0) = 0.

(ii) In Case 2 (f(1)=1f(1) = 1):

By induction on n1n \geq 1: f(n)=f(n1+1)=f(n1)+f(1)=f(n1)+1f(n) = f(n-1 + 1) = f(n-1) + f(1) = f(n-1) + 1. Since f(1)=1f(1) = 1 f(n)=nf(n) = n for all nNn \in \mathbb{N}.

For n=0n = 0: f(0)=0=0f(1)f(0) = 0 = 0 \cdot f(1).

For negative integers: 0=f(0)=f(n+(n))=f(n)+f(n)0 = f(0) = f(n + (-n)) = f(n) + f(-n) So f(n)=f(n)=nf(-n) = -f(n) = -n.

Therefore f(n)=nf(n) = n for all nZn \in \mathbb{Z}.

(iii) We have established that either f(x)=0f(x) = 0 for all xx (Case 1) or f(1)=1f(1) = 1 (Case 2).

In Case 2: For any rational p/qp/q (with q0q \neq 0):

f(pq)=f(pq)f\left(\frac{p}{q}\right) = f\left(\frac{p}{q}\right)

Since f(qpq)=f(q)f(pq)f(q \cdot \frac{p}{q}) = f(q)f(\frac{p}{q}) and f(p)=pf(p) = pWe get p=qf(pq)p = q \cdot f(\frac{p}{q}) So f(pq)=pqf(\frac{p}{q}) = \frac{p}{q}.

For x>0x > 0: f(x)=f(xx)=f(x)20f(x) = f(\sqrt{x} \cdot \sqrt{x}) = f(\sqrt{x})^2 \geq 0.

If x>yx > y: f(x)f(y)=f(xy)0f(x) - f(y) = f(x - y) \geq 0 (since xy>0x - y > 0 and ff of a positive number is Non-negative). Wait, we need to be more careful.

Actually, since f(x)=xf(x) = x for all rationals and ff is additive, for any real xx and rational rr: If r<xr < x then f(x)r=f(x)f(r)=f(xr)f(x) - r = f(x) - f(r) = f(x - r). Since xr>0x - r > 0 and we have shown ff of a Positive number is non-negative, f(x)rf(x) \geq r for all rationals r<xr < x. Hence f(x)xf(x) \geq x.

Similarly, if r>xr > x then f(r)f(x)=f(rx)0f(r) - f(x) = f(r - x) \geq 0 (since rx>0r - x > 0), so f(x)rf(x) \leq r for All rationals r>xr > x. Hence f(x)xf(x) \leq x.

Combining: f(x)=xf(x) = x for all xRx \in \mathbb{R}.

Therefore the only solutions are f(x)=xf(x) = x and f(x)=0f(x) = 0.


The MAT is like a conversation with a friend who happens to be a mathematician. You do not directly recite facts; you must explain your reasoning, anticipate objections, and adjust your approach when something does not work. The multiple choice format traps those who rely on pattern recognition rather than genuine understanding, much like a quiz show rewards depth of knowledge over surface-level recall.

Multiple choice questions on the MAT are like locked doors. You can try to pick the lock through brute-force calculation, or you can look for the key hidden in the structure of the options. Eliminating wrong answers is like narrowing down suspects in a mystery: each eliminated option brings you closer to the truth, and sometimes the remaining answer reveals itself without further effort.

Not reading the question carefully. MAT questions often have specific conditions or constraints that Are easy to miss on a first reading. Re-read the question before writing your solution.

Over-complicating multiple choice. Question 1 parts are designed to be solvable in 3—5 minutes. If you are spending more than 5 minutes on a single part, you are likely missing a shortcut.

Algebraic errors in long-form questions. A sign error in the middle of a derivation can invalidate The rest of the solution. Check your algebra at each step, especially when expanding or factorising.

Incorrect use of logical connectives. Confusing “if” with “if and only if”, or “for all” with “there exists”, is a common source of error in proof questions.

Not checking answers. For computation questions, substitute your answer back into the original Problem. For proof questions, verify that your argument holds for specific cases.

Leaving blanks. On multiple choice, guess if you are unsure: there is no negative marking. On Long-form questions, write down whatever partial progress you have made.

Mismanaging time. Do not spend excessive time on Question 1 at the expense of Questions 2—4, which Carry more marks per minute.

Example 1: Applying key concepts

When working with mat preparation, follow a structured approach:

  1. Identify the key concepts and definitions relevant to the question
  2. Apply the appropriate methods, equations, or frameworks
  3. Support your answer with evidence, examples, or calculations
  4. Evaluate your answer critically, considering limitations and alternative perspectives
flowchart TD
A[Mat Preparation] --> B[Key Concepts]
A --> C[Core Principles]
A --> D[Practical Applications]
B --> E[Fundamental definitions]
C --> F[Design patterns]
D --> G[Real-world usage]
  • The MAT (Mathematics Admissions Test) is a 2.5-hour paper used by Oxford and Imperial for maths and computer science admissions.
  • Part A: 10 multiple-choice questions (4 marks each); Parts B and C: longer questions (15 marks each) requiring full written solutions.
  • Key topics: polynomials, sequences and series, coordinate geometry, calculus, probability, and logical reasoning.
  • Preparation strategy: work through all past papers (2007–present), focus on accuracy over speed initially, then practice under timed conditions.
  • For Computer Science applicants: the logic and algorithm questions in Part C require careful reading of problem specifications.
TopicSiteLink
MAT Past PapersOxford MathsView
TMUA PreparationWyattsNotesView
STEP PreparationWyattsNotesView
Real AnalysisWyattsNotesView
ProbabilityWyattsNotesView